C11H18ClN3O3S — CID 106146436
2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]pyridine-4-sulfonamide (PubChem CID 106146436) has the molecular formula C11H18ClN3O3S and a molecular weight of 307.80 g/mol. Its IUPAC name is 2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 106146436 |
| Molecular Formula | C11H18ClN3O3S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]pyridine-4-sulfonamide |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H18ClN3O3S/c1-11(16,8-15(2)3)7-14-19(17,18)9-4-5-13-10(12)6-9/h4-6,14,16H,7-8H2,1-3H3 |
| InChIKey | DQRXUPRABLBNQV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|