C11H7ClF2N2O3S — CID 64606342
5-chloro-N-(2,6-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 64606342) has the molecular formula C11H7ClF2N2O3S and a molecular weight of 320.70 g/mol. Its IUPAC name is 5-chloro-N-(2,6-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(2,6-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64606342 |
| Molecular Formula | C11H7ClF2N2O3S |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 5-chloro-N-(2,6-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)Nc2c(F)cccc2F)cc1Cl |
| InChI | InChI=1S/C11H7ClF2N2O3S/c12-7-4-6(5-15-11(7)17)20(18,19)16-10-8(13)2-1-3-9(10)14/h1-5,16H,(H,15,17) |
| InChIKey | SGRFMVYPPONLCR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |