C13H15ClFN3O2S — CID 106083665
N-(2-chloro-6-fluorophenyl)-5-(ethylaminomethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106083665) has the molecular formula C13H15ClFN3O2S and a molecular weight of 331.80 g/mol. Its IUPAC name is N-(2-chloro-6-fluorophenyl)-5-(ethylaminomethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(2-chloro-6-fluorophenyl)-5-(ethylaminomethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106083665 |
| Molecular Formula | C13H15ClFN3O2S |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(2-chloro-6-fluorophenyl)-5-(ethylaminomethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)Nc2c(F)cccc2Cl)c[nH]1 |
| InChI | InChI=1S/C13H15ClFN3O2S/c1-2-16-7-9-6-10(8-17-9)21(19,20)18-13-11(14)4-3-5-12(13)15/h3-6,8,16-18H,2,7H2,1H3 |
| InChIKey | IHZUQZHCSSUMLP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |