C12H13ClFN3O2S — CID 106004740
N-(4-chloro-3-fluorophenyl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106004740) has the molecular formula C12H13ClFN3O2S and a molecular weight of 317.77 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106004740 |
| Molecular Formula | C12H13ClFN3O2S |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)Nc2ccc(Cl)c(F)c2)c[nH]1 |
| InChI | InChI=1S/C12H13ClFN3O2S/c1-15-6-9-4-10(7-16-9)20(18,19)17-8-2-3-11(13)12(14)5-8/h2-5,7,15-17H,6H2,1H3 |
| InChIKey | IPIXAVQEKKQSLI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |