C12H9Br2ClN2O3S — CID 64608816
5-chloro-N-(2,6-dibromo-4-methylphenyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 64608816) has the molecular formula C12H9Br2ClN2O3S and a molecular weight of 456.54 g/mol. Its IUPAC name is 5-chloro-N-(2,6-dibromo-4-methylphenyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(2,6-dibromo-4-methylphenyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608816 |
| Molecular Formula | C12H9Br2ClN2O3S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 453.84 |
| IUPAC Name | 5-chloro-N-(2,6-dibromo-4-methylphenyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | Cc1cc(Br)c(NS(=O)(=O)c2c[nH]c(=O)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C12H9Br2ClN2O3S/c1-6-2-8(13)11(9(14)3-6)17-21(19,20)7-4-10(15)12(18)16-5-7/h2-5,17H,1H3,(H,16,18) |
| InChIKey | CVYZBIBUIMPMMV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |