C11H7BrCl2N2O3S — CID 103481116
N-(2-bromo-3-chlorophenyl)-5-chloro-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 103481116) has the molecular formula C11H7BrCl2N2O3S and a molecular weight of 398.07 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-5-chloro-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-5-chloro-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103481116 |
| Molecular Formula | C11H7BrCl2N2O3S |
| Molecular Weight | 398.07 g/mol |
| Exact Mass | 395.87 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-5-chloro-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)Nc2cccc(Cl)c2Br)cc1Cl |
| InChI | InChI=1S/C11H7BrCl2N2O3S/c12-10-7(13)2-1-3-9(10)16-20(18,19)6-4-8(14)11(17)15-5-6/h1-5,16H,(H,15,17) |
| InChIKey | UOFVWXMLSHRSEA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.07 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |