C13H14ClN3O3S — CID 115378925
5-chloro-N-[3-(dimethylamino)phenyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 115378925) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 5-chloro-N-[3-(dimethylamino)phenyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[3-(dimethylamino)phenyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115378925 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 5-chloro-N-[3-(dimethylamino)phenyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CN(C)c1cccc(NS(=O)(=O)c2c[nH]c(=O)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H14ClN3O3S/c1-17(2)10-5-3-4-9(6-10)16-21(19,20)11-7-12(14)13(18)15-8-11/h3-8,16H,1-2H3,(H,15,18) |
| InChIKey | BUDQJVMPJIQDFX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_H(6)', 'substructure': 'N/A'} |
|---|