C14H15Br2NO2S2 — CID 63420862
2,4-dibromo-N-(2-methyl-1-thiophen-2-ylpropyl)benzenesulfonamide (PubChem CID 63420862) has the molecular formula C14H15Br2NO2S2 and a molecular weight of 453.22 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-methyl-1-thiophen-2-ylpropyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(2-methyl-1-thiophen-2-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63420862 |
| Molecular Formula | C14H15Br2NO2S2 |
| Molecular Weight | 453.22 g/mol |
| Exact Mass | 450.89 |
| IUPAC Name | 2,4-dibromo-N-(2-methyl-1-thiophen-2-ylpropyl)benzenesulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(Br)cc1Br)c1cccs1 |
| InChI | InChI=1S/C14H15Br2NO2S2/c1-9(2)14(12-4-3-7-20-12)17-21(18,19)13-6-5-10(15)8-11(13)16/h3-9,14,17H,1-2H3 |
| InChIKey | DDWGPWUXIMOPIC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.22 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |