C9H10ClF4N3O2S — CID 106295502
5-chloro-6-(methylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-3-sulfonamide (PubChem CID 106295502) has the molecular formula C9H10ClF4N3O2S and a molecular weight of 335.71 g/mol. Its IUPAC name is 5-chloro-6-(methylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(methylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106295502 |
| Molecular Formula | C9H10ClF4N3O2S |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 5-chloro-6-(methylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)NCC(F)(F)C(F)F)cc1Cl |
| InChI | InChI=1S/C9H10ClF4N3O2S/c1-15-7-6(10)2-5(3-16-7)20(18,19)17-4-9(13,14)8(11)12/h2-3,8,17H,4H2,1H3,(H,15,16) |
| InChIKey | AAAQFDBKUUGCHQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|