C11H14ClN5O2S — CID 64601125
5-chloro-6-(methylamino)-N-[(1-methylimidazol-2-yl)methyl]pyridine-3-sulfonamide (PubChem CID 64601125) has the molecular formula C11H14ClN5O2S and a molecular weight of 315.79 g/mol. Its IUPAC name is 5-chloro-6-(methylamino)-N-[(1-methylimidazol-2-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(methylamino)-N-[(1-methylimidazol-2-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64601125 |
| Molecular Formula | C11H14ClN5O2S |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 5-chloro-6-(methylamino)-N-[(1-methylimidazol-2-yl)methyl]pyridine-3-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)NCc2nccn2C)cc1Cl |
| InChI | InChI=1S/C11H14ClN5O2S/c1-13-11-9(12)5-8(6-15-11)20(18,19)16-7-10-14-3-4-17(10)2/h3-6,16H,7H2,1-2H3,(H,13,15) |
| InChIKey | DLPRSJKFOVJMJD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |