C11H12Cl2N4O2S — CID 64608216
5,6-dichloro-N-[2-(1-methylimidazol-2-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 64608216) has the molecular formula C11H12Cl2N4O2S and a molecular weight of 335.22 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-(1-methylimidazol-2-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[2-(1-methylimidazol-2-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608216 |
| Molecular Formula | C11H12Cl2N4O2S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 5,6-dichloro-N-[2-(1-methylimidazol-2-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | Cn1ccnc1CCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N4O2S/c1-17-5-4-14-10(17)2-3-16-20(18,19)8-6-9(12)11(13)15-7-8/h4-7,16H,2-3H2,1H3 |
| InChIKey | NGSUNFVYWRXEEM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|