C12H20N6O2S — CID 106017953
1-[2-(methylamino)ethyl]-N-[2-(1-methylimidazol-2-yl)ethyl]pyrazole-4-sulfonamide (PubChem CID 106017953) has the molecular formula C12H20N6O2S and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-[2-(methylamino)ethyl]-N-[2-(1-methylimidazol-2-yl)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-[2-(methylamino)ethyl]-N-[2-(1-methylimidazol-2-yl)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106017953 |
| Molecular Formula | C12H20N6O2S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[2-(methylamino)ethyl]-N-[2-(1-methylimidazol-2-yl)ethyl]pyrazole-4-sulfonamide |
| SMILES | CNCCn1cc(S(=O)(=O)NCCc2nccn2C)cn1 |
| InChI | InChI=1S/C12H20N6O2S/c1-13-5-8-18-10-11(9-15-18)21(19,20)16-4-3-12-14-6-7-17(12)2/h6-7,9-10,13,16H,3-5,8H2,1-2H3 |
| InChIKey | MKRQQACHIPKQPT-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |