C13H20ClN3O2S — CID 64600883
5-chloro-N-(2-cyclopentylethyl)-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 64600883) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 5-chloro-N-(2-cyclopentylethyl)-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(2-cyclopentylethyl)-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64600883 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 5-chloro-N-(2-cyclopentylethyl)-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)NCCC2CCCC2)cc1Cl |
| InChI | InChI=1S/C13H20ClN3O2S/c1-15-13-12(14)8-11(9-16-13)20(18,19)17-7-6-10-4-2-3-5-10/h8-10,17H,2-7H2,1H3,(H,15,16) |
| InChIKey | HWVMABOKEONSBB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |