C12H19ClN4O3S — CID 64608502
5-chloro-6-(methylamino)-N-(2-morpholin-4-ylethyl)pyridine-3-sulfonamide (PubChem CID 64608502) has the molecular formula C12H19ClN4O3S and a molecular weight of 334.83 g/mol. Its IUPAC name is 5-chloro-6-(methylamino)-N-(2-morpholin-4-ylethyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(methylamino)-N-(2-morpholin-4-ylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608502 |
| Molecular Formula | C12H19ClN4O3S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 5-chloro-6-(methylamino)-N-(2-morpholin-4-ylethyl)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)NCCN2CCOCC2)cc1Cl |
| InChI | InChI=1S/C12H19ClN4O3S/c1-14-12-11(13)8-10(9-15-12)21(18,19)16-2-3-17-4-6-20-7-5-17/h8-9,16H,2-7H2,1H3,(H,14,15) |
| InChIKey | JYYNEISXGDXUMH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |