C13H18Cl2N4O4S — CID 110305451
2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 110305451) has the molecular formula C13H18Cl2N4O4S and a molecular weight of 397.28 g/mol. Its IUPAC name is 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 110305451 |
| Molecular Formula | C13H18Cl2N4O4S |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cnc(Cl)c(Cl)c1)NCCN1CCOCC1 |
| InChI | InChI=1S/C13H18Cl2N4O4S/c14-11-7-10(8-17-13(11)15)24(21,22)18-9-12(20)16-1-2-19-3-5-23-6-4-19/h7-8,18H,1-6,9H2,(H,16,20) |
| InChIKey | UCDVMYUJABCROG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|