C12H19ClN4O3S — CID 64601463
2-[[5-chloro-6-(ethylamino)-3-pyridinyl]sulfonylamino]-N-propylacetamide (PubChem CID 64601463) has the molecular formula C12H19ClN4O3S and a molecular weight of 334.83 g/mol. Its IUPAC name is 2-[[5-chloro-6-(ethylamino)-3-pyridinyl]sulfonylamino]-N-propylacetamide.
| Compound Name | 2-[[5-chloro-6-(ethylamino)-3-pyridinyl]sulfonylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 64601463 |
| Molecular Formula | C12H19ClN4O3S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-[[5-chloro-6-(ethylamino)-3-pyridinyl]sulfonylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNS(=O)(=O)c1cnc(NCC)c(Cl)c1 |
| InChI | InChI=1S/C12H19ClN4O3S/c1-3-5-15-11(18)8-17-21(19,20)9-6-10(13)12(14-4-2)16-7-9/h6-7,17H,3-5,8H2,1-2H3,(H,14,16)(H,15,18) |
| InChIKey | UUOCBSUNVSYASJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |