C14H17ClN4O2S — CID 136574861
5-chloro-6-(ethylamino)-N-(2-pyridin-3-ylethyl)pyridine-3-sulfonamide (PubChem CID 136574861) has the molecular formula C14H17ClN4O2S and a molecular weight of 340.84 g/mol. Its IUPAC name is 5-chloro-6-(ethylamino)-N-(2-pyridin-3-ylethyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(ethylamino)-N-(2-pyridin-3-ylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 136574861 |
| Molecular Formula | C14H17ClN4O2S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 5-chloro-6-(ethylamino)-N-(2-pyridin-3-ylethyl)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)NCCc2cccnc2)cc1Cl |
| InChI | InChI=1S/C14H17ClN4O2S/c1-2-17-14-13(15)8-12(10-18-14)22(20,21)19-7-5-11-4-3-6-16-9-11/h3-4,6,8-10,19H,2,5,7H2,1H3,(H,17,18) |
| InChIKey | YLSOCTSWIRYMCE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |