C14H12ClN3O2S — CID 80697531
2-chloro-5-cyano-N-(2-pyridin-3-ylethyl)benzenesulfonamide (PubChem CID 80697531) has the molecular formula C14H12ClN3O2S and a molecular weight of 321.79 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-(2-pyridin-3-ylethyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-cyano-N-(2-pyridin-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 80697531 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-chloro-5-cyano-N-(2-pyridin-3-ylethyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)c(S(=O)(=O)NCCc2cccnc2)c1 |
| InChI | InChI=1S/C14H12ClN3O2S/c15-13-4-3-12(9-16)8-14(13)21(19,20)18-7-5-11-2-1-6-17-10-11/h1-4,6,8,10,18H,5,7H2 |
| InChIKey | VHCXMICNTILPCT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |