C12H10ClN3O2S2 — CID 80704123
2-chloro-5-cyano-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 80704123) has the molecular formula C12H10ClN3O2S2 and a molecular weight of 327.82 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-chloro-5-cyano-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 80704123 |
| Molecular Formula | C12H10ClN3O2S2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-chloro-5-cyano-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)c(S(=O)(=O)NCCc2cscn2)c1 |
| InChI | InChI=1S/C12H10ClN3O2S2/c13-11-2-1-9(6-14)5-12(11)20(17,18)16-4-3-10-7-19-8-15-10/h1-2,5,7-8,16H,3-4H2 |
| InChIKey | SDYRJAIXZKFHSK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |