C12H16ClN5O2S — CID 65236588
5-chloro-6-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 65236588) has the molecular formula C12H16ClN5O2S and a molecular weight of 329.81 g/mol. Its IUPAC name is 5-chloro-6-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 65236588 |
| Molecular Formula | C12H16ClN5O2S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-chloro-6-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)NCCc2cnc[nH]2)cc1Cl |
| InChI | InChI=1S/C12H16ClN5O2S/c1-2-15-12-11(13)5-10(7-16-12)21(19,20)18-4-3-9-6-14-8-17-9/h5-8,18H,2-4H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | BUHQZQJFHUYYAI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |