C11H11ClN4O4S — CID 40559388
4-chloro-N-[2-(1H-imidazol-5-yl)ethyl]-3-nitrobenzenesulfonamide (PubChem CID 40559388) has the molecular formula C11H11ClN4O4S and a molecular weight of 330.75 g/mol. Its IUPAC name is 4-chloro-N-[2-(1H-imidazol-5-yl)ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(1H-imidazol-5-yl)ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 40559388 |
| Molecular Formula | C11H11ClN4O4S |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 4-chloro-N-[2-(1H-imidazol-5-yl)ethyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCCc2cnc[nH]2)ccc1Cl |
| InChI | InChI=1S/C11H11ClN4O4S/c12-10-2-1-9(5-11(10)16(17)18)21(19,20)15-4-3-8-6-13-7-14-8/h1-2,5-7,15H,3-4H2,(H,13,14) |
| InChIKey | DVIZEMVGMHWAFQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|