C9H8ClN2O6S- — CID 7062896
3-[(4-chloro-3-nitrophenyl)sulfonylamino]propanoate (PubChem CID 7062896) has the molecular formula C9H8ClN2O6S- and a molecular weight of 307.69 g/mol. Its IUPAC name is 3-[(4-chloro-3-nitrophenyl)sulfonylamino]propanoate.
| Compound Name | 3-[(4-chloro-3-nitrophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7062896 |
| Molecular Formula | C9H8ClN2O6S- |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 3-[(4-chloro-3-nitrophenyl)sulfonylamino]propanoate |
| SMILES | O=C([O-])CCNS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9ClN2O6S/c10-7-2-1-6(5-8(7)12(15)16)19(17,18)11-4-3-9(13)14/h1-2,5,11H,3-4H2,(H,13,14)/p-1 |
| InChIKey | GGGMKFRZMMBWDB-UHFFFAOYSA-M |
| XLogP | -0.33 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|