C7H8ClN2O7PS — CID 22179300
[(4-chloro-3-nitrophenyl)sulfonylamino]methylphosphonic acid (PubChem CID 22179300) has the molecular formula C7H8ClN2O7PS and a molecular weight of 330.64 g/mol. Its IUPAC name is [(4-chloro-3-nitrophenyl)sulfonylamino]methylphosphonic acid.
| Compound Name | [(4-chloro-3-nitrophenyl)sulfonylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 22179300 |
| Molecular Formula | C7H8ClN2O7PS |
| Molecular Weight | 330.64 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | [(4-chloro-3-nitrophenyl)sulfonylamino]methylphosphonic acid |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCP(=O)(O)O)ccc1Cl |
| InChI | InChI=1S/C7H8ClN2O7PS/c8-6-2-1-5(3-7(6)10(11)12)19(16,17)9-4-18(13,14)15/h1-3,9H,4H2,(H2,13,14,15) |
| InChIKey | PJPIHUPLWCHNLY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.64 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|