C10H13ClN2O5S — CID 65034448
4-chloro-N-(3-hydroxy-2-methylpropyl)-3-nitrobenzenesulfonamide (PubChem CID 65034448) has the molecular formula C10H13ClN2O5S and a molecular weight of 308.74 g/mol. Its IUPAC name is 4-chloro-N-(3-hydroxy-2-methylpropyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-(3-hydroxy-2-methylpropyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 65034448 |
| Molecular Formula | C10H13ClN2O5S |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-chloro-N-(3-hydroxy-2-methylpropyl)-3-nitrobenzenesulfonamide |
| SMILES | CC(CO)CNS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13ClN2O5S/c1-7(6-14)5-12-19(17,18)8-2-3-9(11)10(4-8)13(15)16/h2-4,7,12,14H,5-6H2,1H3 |
| InChIKey | ZMANFVJKHUPNIY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|