C7H10ClN3O2S — CID 64608699
5-chloro-6-(ethylamino)pyridine-3-sulfonamide (PubChem CID 64608699) has the molecular formula C7H10ClN3O2S and a molecular weight of 235.70 g/mol. Its IUPAC name is 5-chloro-6-(ethylamino)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(ethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608699 |
| Molecular Formula | C7H10ClN3O2S |
| Molecular Weight | 235.70 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 5-chloro-6-(ethylamino)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C7H10ClN3O2S/c1-2-10-7-6(8)3-5(4-11-7)14(9,12)13/h3-4H,2H2,1H3,(H,10,11)(H2,9,12,13) |
| InChIKey | DRSJFXICTYQAFW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.70 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |