C13H22ClN3O2S — CID 64601073
5-chloro-6-(ethylamino)-N-methyl-N-(3-methylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 64601073) has the molecular formula C13H22ClN3O2S and a molecular weight of 319.86 g/mol. Its IUPAC name is 5-chloro-6-(ethylamino)-N-methyl-N-(3-methylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(ethylamino)-N-methyl-N-(3-methylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64601073 |
| Molecular Formula | C13H22ClN3O2S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5-chloro-6-(ethylamino)-N-methyl-N-(3-methylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)N(C)C(C)C(C)C)cc1Cl |
| InChI | InChI=1S/C13H22ClN3O2S/c1-6-15-13-12(14)7-11(8-16-13)20(18,19)17(5)10(4)9(2)3/h7-10H,6H2,1-5H3,(H,15,16) |
| InChIKey | IVHOXCVGSDNTMT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |