C14H24ClN3O2S — CID 64600685
5-chloro-N-methyl-N-pentan-3-yl-6-(propylamino)pyridine-3-sulfonamide (PubChem CID 64600685) has the molecular formula C14H24ClN3O2S and a molecular weight of 333.89 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-pentan-3-yl-6-(propylamino)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-methyl-N-pentan-3-yl-6-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64600685 |
| Molecular Formula | C14H24ClN3O2S |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 5-chloro-N-methyl-N-pentan-3-yl-6-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncc(S(=O)(=O)N(C)C(CC)CC)cc1Cl |
| InChI | InChI=1S/C14H24ClN3O2S/c1-5-8-16-14-13(15)9-12(10-17-14)21(19,20)18(4)11(6-2)7-3/h9-11H,5-8H2,1-4H3,(H,16,17) |
| InChIKey | GITKNOODIYZDLH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |