C17H22ClN3O3S — CID 113239391
N-benzyl-5-chloro-N-(2-hydroxyethyl)-6-(propylamino)pyridine-3-sulfonamide (PubChem CID 113239391) has the molecular formula C17H22ClN3O3S and a molecular weight of 383.90 g/mol. Its IUPAC name is N-benzyl-5-chloro-N-(2-hydroxyethyl)-6-(propylamino)pyridine-3-sulfonamide.
| Compound Name | N-benzyl-5-chloro-N-(2-hydroxyethyl)-6-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113239391 |
| Molecular Formula | C17H22ClN3O3S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-benzyl-5-chloro-N-(2-hydroxyethyl)-6-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncc(S(=O)(=O)N(CCO)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C17H22ClN3O3S/c1-2-8-19-17-16(18)11-15(12-20-17)25(23,24)21(9-10-22)13-14-6-4-3-5-7-14/h3-7,11-12,22H,2,8-10,13H2,1H3,(H,19,20) |
| InChIKey | JMUNLFATTJHFHY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |