C18H23NO4S — CID 113228610
N-benzyl-N-(2-hydroxyethyl)-3-(1-hydroxypropyl)benzenesulfonamide (PubChem CID 113228610) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-3-(1-hydroxypropyl)benzenesulfonamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-3-(1-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113228610 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-3-(1-hydroxypropyl)benzenesulfonamide |
| SMILES | CCC(O)c1cccc(S(=O)(=O)N(CCO)Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H23NO4S/c1-2-18(21)16-9-6-10-17(13-16)24(22,23)19(11-12-20)14-15-7-4-3-5-8-15/h3-10,13,18,20-21H,2,11-12,14H2,1H3 |
| InChIKey | RAPQEMWSBAVENS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |