C12H19NO3S — CID 43507253
N,N-diethyl-3-(1-hydroxyethyl)benzenesulfonamide (PubChem CID 43507253) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is N,N-diethyl-3-(1-hydroxyethyl)benzenesulfonamide.
| Compound Name | N,N-diethyl-3-(1-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43507253 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N,N-diethyl-3-(1-hydroxyethyl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(C)O)c1 |
| InChI | InChI=1S/C12H19NO3S/c1-4-13(5-2)17(15,16)12-8-6-7-11(9-12)10(3)14/h6-10,14H,4-5H2,1-3H3 |
| InChIKey | JUYAALHHHRCGOV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |