C15H26N2O3S — CID 79378974
3-(1-aminopropyl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)benzenesulfonamide (PubChem CID 79378974) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-(1-aminopropyl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)benzenesulfonamide.
| Compound Name | 3-(1-aminopropyl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79378974 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-(1-aminopropyl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)benzenesulfonamide |
| SMILES | CCC(N)c1cccc(S(=O)(=O)N(CC)CC(C)(C)O)c1 |
| InChI | InChI=1S/C15H26N2O3S/c1-5-14(16)12-8-7-9-13(10-12)21(19,20)17(6-2)11-15(3,4)18/h7-10,14,18H,5-6,11,16H2,1-4H3 |
| InChIKey | MKVFYYXGSHQGRU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |