C13H18F3NO3S — CID 79378419
N-ethyl-N-(2-hydroxy-2-methylpropyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 79378419) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxy-2-methylpropyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79378419 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO3S/c1-4-17(9-12(2,3)18)21(19,20)11-7-5-6-10(8-11)13(14,15)16/h5-8,18H,4,9H2,1-3H3 |
| InChIKey | JTTGUIVBZIAVAP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |