C19H21F3N2O3S2 — CID 17432681
N-[3-(diethylsulfamoyl)phenyl]-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 17432681) has the molecular formula C19H21F3N2O3S2 and a molecular weight of 446.52 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)phenyl]-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-[3-(diethylsulfamoyl)phenyl]-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 17432681 |
| Molecular Formula | C19H21F3N2O3S2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[3-(diethylsulfamoyl)phenyl]-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)CSc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H21F3N2O3S2/c1-3-24(4-2)29(26,27)17-10-6-8-15(12-17)23-18(25)13-28-16-9-5-7-14(11-16)19(20,21)22/h5-12H,3-4,13H2,1-2H3,(H,23,25) |
| InChIKey | BMROOOOGPCNXII-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |