C9H12ClF3N4O3S — CID 107480756
5-chloro-6-hydrazinyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide (PubChem CID 107480756) has the molecular formula C9H12ClF3N4O3S and a molecular weight of 348.73 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107480756 |
| Molecular Formula | C9H12ClF3N4O3S |
| Molecular Weight | 348.73 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)N(CCO)CC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H12ClF3N4O3S/c10-7-3-6(4-15-8(7)16-14)21(19,20)17(1-2-18)5-9(11,12)13/h3-4,18H,1-2,5,14H2,(H,15,16) |
| InChIKey | OKHNHAOLGHIVKU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.73 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|