C9H9ClN6O2S — CID 64607392
5-chloro-N,N-bis(cyanomethyl)-6-hydrazinylpyridine-3-sulfonamide (PubChem CID 64607392) has the molecular formula C9H9ClN6O2S and a molecular weight of 300.73 g/mol. Its IUPAC name is 5-chloro-N,N-bis(cyanomethyl)-6-hydrazinylpyridine-3-sulfonamide.
| Compound Name | 5-chloro-N,N-bis(cyanomethyl)-6-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607392 |
| Molecular Formula | C9H9ClN6O2S |
| Molecular Weight | 300.73 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 5-chloro-N,N-bis(cyanomethyl)-6-hydrazinylpyridine-3-sulfonamide |
| SMILES | N#CCN(CC#N)S(=O)(=O)c1cnc(NN)c(Cl)c1 |
| InChI | InChI=1S/C9H9ClN6O2S/c10-8-5-7(6-14-9(8)15-13)19(17,18)16(3-1-11)4-2-12/h5-6H,3-4,13H2,(H,14,15) |
| InChIKey | PYQVVLNIZFCBFG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.73 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|