C10H14ClN5O2S — CID 64608758
5-chloro-N-(2-cyanopropyl)-6-hydrazinyl-N-methylpyridine-3-sulfonamide (PubChem CID 64608758) has the molecular formula C10H14ClN5O2S and a molecular weight of 303.78 g/mol. Its IUPAC name is 5-chloro-N-(2-cyanopropyl)-6-hydrazinyl-N-methylpyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(2-cyanopropyl)-6-hydrazinyl-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608758 |
| Molecular Formula | C10H14ClN5O2S |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-chloro-N-(2-cyanopropyl)-6-hydrazinyl-N-methylpyridine-3-sulfonamide |
| SMILES | CC(C#N)CN(C)S(=O)(=O)c1cnc(NN)c(Cl)c1 |
| InChI | InChI=1S/C10H14ClN5O2S/c1-7(4-12)6-16(2)19(17,18)8-3-9(11)10(15-13)14-5-8/h3,5,7H,6,13H2,1-2H3,(H,14,15) |
| InChIKey | BWPIPXWPIQDOEB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|