C11H15ClN4O2S — CID 64600117
5-chloro-N-(2-cyanopropyl)-N-methyl-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 64600117) has the molecular formula C11H15ClN4O2S and a molecular weight of 302.79 g/mol. Its IUPAC name is 5-chloro-N-(2-cyanopropyl)-N-methyl-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(2-cyanopropyl)-N-methyl-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64600117 |
| Molecular Formula | C11H15ClN4O2S |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-chloro-N-(2-cyanopropyl)-N-methyl-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)N(C)CC(C)C#N)cc1Cl |
| InChI | InChI=1S/C11H15ClN4O2S/c1-8(5-13)7-16(3)19(17,18)9-4-10(12)11(14-2)15-6-9/h4,6,8H,7H2,1-3H3,(H,14,15) |
| InChIKey | BAUXWPDAIYBISH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |