C12H19N5O2S — CID 62159264
N-(2-cyanopropyl)-N-methyl-2-(propylamino)pyrimidine-5-sulfonamide (PubChem CID 62159264) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(2-cyanopropyl)-N-methyl-2-(propylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-(2-cyanopropyl)-N-methyl-2-(propylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62159264 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-(2-cyanopropyl)-N-methyl-2-(propylamino)pyrimidine-5-sulfonamide |
| SMILES | CCCNc1ncc(S(=O)(=O)N(C)CC(C)C#N)cn1 |
| InChI | InChI=1S/C12H19N5O2S/c1-4-5-14-12-15-7-11(8-16-12)20(18,19)17(3)9-10(2)6-13/h7-8,10H,4-5,9H2,1-3H3,(H,14,15,16) |
| InChIKey | ZNEJCPYATWZZLP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |