C13H24N4O2S — CID 62150752
N,N-dipropyl-2-(propylamino)pyrimidine-5-sulfonamide (PubChem CID 62150752) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is N,N-dipropyl-2-(propylamino)pyrimidine-5-sulfonamide.
| Compound Name | N,N-dipropyl-2-(propylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62150752 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N,N-dipropyl-2-(propylamino)pyrimidine-5-sulfonamide |
| SMILES | CCCNc1ncc(S(=O)(=O)N(CCC)CCC)cn1 |
| InChI | InChI=1S/C13H24N4O2S/c1-4-7-14-13-15-10-12(11-16-13)20(18,19)17(8-5-2)9-6-3/h10-11H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | XPJQPCRGWKGSJX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |