C8H12ClN3O2S — CID 64607736
5-chloro-N,N-dimethyl-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 64607736) has the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. Its IUPAC name is 5-chloro-N,N-dimethyl-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N,N-dimethyl-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607736 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 5-chloro-N,N-dimethyl-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C8H12ClN3O2S/c1-10-8-7(9)4-6(5-11-8)15(13,14)12(2)3/h4-5H,1-3H3,(H,10,11) |
| InChIKey | ZTEIGIWMAHYDKQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |