C13H23ClN4O2S — CID 102996715
5-chloro-N-[3-(dimethylamino)propyl]-N-ethyl-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 102996715) has the molecular formula C13H23ClN4O2S and a molecular weight of 334.87 g/mol. Its IUPAC name is 5-chloro-N-[3-(dimethylamino)propyl]-N-ethyl-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[3-(dimethylamino)propyl]-N-ethyl-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 102996715 |
| Molecular Formula | C13H23ClN4O2S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5-chloro-N-[3-(dimethylamino)propyl]-N-ethyl-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CCN(CCCN(C)C)S(=O)(=O)c1cnc(NC)c(Cl)c1 |
| InChI | InChI=1S/C13H23ClN4O2S/c1-5-18(8-6-7-17(3)4)21(19,20)11-9-12(14)13(15-2)16-10-11/h9-10H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | FUXCERQCJVUDSD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |