C12H20ClN3O3S — CID 102995739
5-chloro-N-[3-(dimethylamino)propyl]-N-ethyl-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 102995739) has the molecular formula C12H20ClN3O3S and a molecular weight of 321.83 g/mol. Its IUPAC name is 5-chloro-N-[3-(dimethylamino)propyl]-N-ethyl-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[3-(dimethylamino)propyl]-N-ethyl-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 102995739 |
| Molecular Formula | C12H20ClN3O3S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 5-chloro-N-[3-(dimethylamino)propyl]-N-ethyl-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CCN(CCCN(C)C)S(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C12H20ClN3O3S/c1-4-16(7-5-6-15(2)3)20(18,19)10-8-11(13)12(17)14-9-10/h8-9H,4-7H2,1-3H3,(H,14,17) |
| InChIKey | DQPUSAJGSBQVRT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |