C10H15ClN2O4S — CID 113499786
5-chloro-N-(3-hydroxybutyl)-N-methyl-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 113499786) has the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. Its IUPAC name is 5-chloro-N-(3-hydroxybutyl)-N-methyl-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(3-hydroxybutyl)-N-methyl-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113499786 |
| Molecular Formula | C10H15ClN2O4S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-chloro-N-(3-hydroxybutyl)-N-methyl-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CC(O)CCN(C)S(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C10H15ClN2O4S/c1-7(14)3-4-13(2)18(16,17)8-5-9(11)10(15)12-6-8/h5-7,14H,3-4H2,1-2H3,(H,12,15) |
| InChIKey | FIVRFWPTJLBWPM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |