C12H17ClN2O4S — CID 64606943
5-chloro-N-ethyl-6-oxo-N-(oxolan-2-ylmethyl)-1H-pyridine-3-sulfonamide (PubChem CID 64606943) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is 5-chloro-N-ethyl-6-oxo-N-(oxolan-2-ylmethyl)-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-ethyl-6-oxo-N-(oxolan-2-ylmethyl)-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64606943 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-chloro-N-ethyl-6-oxo-N-(oxolan-2-ylmethyl)-1H-pyridine-3-sulfonamide |
| SMILES | CCN(CC1CCCO1)S(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2O4S/c1-2-15(8-9-4-3-5-19-9)20(17,18)10-6-11(13)12(16)14-7-10/h6-7,9H,2-5,8H2,1H3,(H,14,16) |
| InChIKey | SGXMIFSOVYTMDK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |