C12H18ClN3O3S — CID 64602639
6-amino-5-chloro-N-ethyl-N-(oxolan-2-ylmethyl)pyridine-3-sulfonamide (PubChem CID 64602639) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is 6-amino-5-chloro-N-ethyl-N-(oxolan-2-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-ethyl-N-(oxolan-2-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64602639 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 6-amino-5-chloro-N-ethyl-N-(oxolan-2-ylmethyl)pyridine-3-sulfonamide |
| SMILES | CCN(CC1CCCO1)S(=O)(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClN3O3S/c1-2-16(8-9-4-3-5-19-9)20(17,18)10-6-11(13)12(14)15-7-10/h6-7,9H,2-5,8H2,1H3,(H2,14,15) |
| InChIKey | NKNIASXKEFPNOV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |