C14H18N2O3S — CID 94198707
3-cyano-N-ethyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide (PubChem CID 94198707) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-cyano-N-ethyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-ethyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 94198707 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-cyano-N-ethyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide |
| SMILES | CCN(C[C@@H]1CCCO1)S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H18N2O3S/c1-2-16(11-13-6-4-8-19-13)20(17,18)14-7-3-5-12(9-14)10-15/h3,5,7,9,13H,2,4,6,8,11H2,1H3/t13-/m0/s1 |
| InChIKey | DOPFMSMGHAABHN-ZDUSSCGKSA-N |
| XLogP | 1.75 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |