C12H16FNO5S2 — CID 114791453
3-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 114791453) has the molecular formula C12H16FNO5S2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 3-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 3-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114791453 |
| Molecular Formula | C12H16FNO5S2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CN(CC1CCCO1)S(=O)(=O)c1cccc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C12H16FNO5S2/c1-14(9-10-4-3-7-19-10)21(17,18)12-6-2-5-11(8-12)20(13,15)16/h2,5-6,8,10H,3-4,7,9H2,1H3 |
| InChIKey | HVANYIUXTRJHOO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |