C13H18FNO3S — CID 60750571
4-fluoro-N-methyl-N-(oxan-2-ylmethyl)benzenesulfonamide (PubChem CID 60750571) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-fluoro-N-methyl-N-(oxan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-methyl-N-(oxan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60750571 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-fluoro-N-methyl-N-(oxan-2-ylmethyl)benzenesulfonamide |
| SMILES | CN(CC1CCCCO1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO3S/c1-15(10-12-4-2-3-9-18-12)19(16,17)13-7-5-11(14)6-8-13/h5-8,12H,2-4,9-10H2,1H3 |
| InChIKey | ZJOWRFNFYRQSRE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |