C17H24N2O4S — CID 97109915
4-[methyl-[[(2R)-oxan-2-yl]methyl]sulfamoyl]-N-prop-2-enylbenzamide (PubChem CID 97109915) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-[methyl-[[(2R)-oxan-2-yl]methyl]sulfamoyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-[methyl-[[(2R)-oxan-2-yl]methyl]sulfamoyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 97109915 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[methyl-[[(2R)-oxan-2-yl]methyl]sulfamoyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(S(=O)(=O)N(C)C[C@H]2CCCCO2)cc1 |
| InChI | InChI=1S/C17H24N2O4S/c1-3-11-18-17(20)14-7-9-16(10-8-14)24(21,22)19(2)13-15-6-4-5-12-23-15/h3,7-10,15H,1,4-6,11-13H2,2H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | KEGWGVNGPAJNCT-OAHLLOKOSA-N |
| XLogP | 1.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|