C16H22N2O5S — CID 97130216
N-cyclopropyl-4-[[(2S)-1,4-dioxan-2-yl]methyl-methylsulfamoyl]benzamide (PubChem CID 97130216) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is N-cyclopropyl-4-[[(2S)-1,4-dioxan-2-yl]methyl-methylsulfamoyl]benzamide.
| Compound Name | N-cyclopropyl-4-[[(2S)-1,4-dioxan-2-yl]methyl-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 97130216 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-cyclopropyl-4-[[(2S)-1,4-dioxan-2-yl]methyl-methylsulfamoyl]benzamide |
| SMILES | CN(C[C@H]1COCCO1)S(=O)(=O)c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C16H22N2O5S/c1-18(10-14-11-22-8-9-23-14)24(20,21)15-6-2-12(3-7-15)16(19)17-13-4-5-13/h2-3,6-7,13-14H,4-5,8-11H2,1H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | ZPOJAPFVZQLKRB-AWEZNQCLSA-N |
| XLogP | 0.61 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |